About propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate
propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate (PubChem CID 107454389) has the molecular formula C11H21NO2S
and a molecular weight of 231.36 g/mol. Its IUPAC name is propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate |
| PubChem CID | 107454389 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate |
| SMILES | CC(C)OC(=O)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C11H21NO2S/c1-9(2)14-10(13)12-6-5-11(3,4)15-8-7-12/h9H,5-8H2,1-4H3 |
| InChIKey | XVKFCJBVMPRIGI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate?
The IUPAC name of propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate (CID 107454389) is propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate.
What is the SMILES notation for propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate?
The canonical SMILES for propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate is CC(C)OC(=O)N1CCSC(C)(C)CC1.
What is the InChIKey of propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate?
The InChIKey is XVKFCJBVMPRIGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2S/c1-9(2)14-10(13)12-6-5-11(3,4)15-8-7-12/h9H,5-8H2,1-4H3.
What are the key properties of propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate?
propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate has a molecular weight of 231.36 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 7,7-dimethyl-1,4-thiazepane-4-carboxylate is sourced from PubChem (CID 107454389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).