About 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane
4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane (PubChem CID 107454427) has the molecular formula C12H18ClN3S
and a molecular weight of 271.82 g/mol. Its IUPAC name is 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane |
| PubChem CID | 107454427 |
| Molecular Formula | C12H18ClN3S |
| Molecular Weight | 271.82 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC1(C)CCN(Cc2cnc(Cl)cn2)CCS1 |
| InChI | InChI=1S/C12H18ClN3S/c1-12(2)3-4-16(5-6-17-12)9-10-7-15-11(13)8-14-10/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | UNQMHNUPNGJBFY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.82 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane?
The IUPAC name of 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane (CID 107454427) is 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane.
What is the SMILES notation for 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane?
The canonical SMILES for 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane is CC1(C)CCN(Cc2cnc(Cl)cn2)CCS1.
What is the InChIKey of 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane?
The InChIKey is UNQMHNUPNGJBFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3S/c1-12(2)3-4-16(5-6-17-12)9-10-7-15-11(13)8-14-10/h7-8H,3-6,9H2,1-2H3.
What are the key properties of 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane?
4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane has a molecular weight of 271.82 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chloropyrazin-2-yl)methyl]-7,7-dimethyl-1,4-thiazepane is sourced from PubChem (CID 107454427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).