C34H36N4O4 — CID 10745531
[3-(dimethylamino)phenyl] N-[1-(2-adamantyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate (PubChem CID 10745531) has the molecular formula C34H36N4O4 and a molecular weight of 564.69 g/mol. Its IUPAC name is [3-(dimethylamino)phenyl] N-[1-(2-adamantyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate.
| Compound Name | [3-(dimethylamino)phenyl] N-[1-(2-adamantyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 10745531 |
| Molecular Formula | C34H36N4O4 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | [3-(dimethylamino)phenyl] N-[1-(2-adamantyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate |
| SMILES | CN(C)c1cccc(OC(=O)NC2C(=O)N(c3ccccc3)c3ccccc3N(C3C4CC5CC(C4)CC3C5)C2=O)c1 |
| InChI | InChI=1S/C34H36N4O4/c1-36(2)26-11-8-12-27(20-26)42-34(41)35-30-32(39)37(25-9-4-3-5-10-25)28-13-6-7-14-29(28)38(33(30)40)31-23-16-21-15-22(18-23)19-24(31)17-21/h3-14,20-24,30-31H,15-19H2,1-2H3,(H,35,41) |
| InChIKey | JCJNWACFOVQPJU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|