C33H50O6Si — CID 10745650
ethyl (4S)-7-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propoxy]heptanoate (PubChem CID 10745650) has the molecular formula C33H50O6Si and a molecular weight of 570.84 g/mol. Its IUPAC name is ethyl (4S)-7-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propoxy]heptanoate.
| Compound Name | ethyl (4S)-7-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propoxy]heptanoate |
|---|---|
| PubChem CID | 10745650 |
| Molecular Formula | C33H50O6Si |
| Molecular Weight | 570.84 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | ethyl (4S)-7-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propoxy]heptanoate |
| SMILES | CCOC(=O)CC[C@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[C@@H](CC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C33H50O6Si/c1-8-29(30-25-36-33(6,7)39-30)38-26(22-23-31(34)35-9-2)17-16-24-37-40(32(3,4)5,27-18-12-10-13-19-27)28-20-14-11-15-21-28/h10-15,18-21,26,29-30H,8-9,16-17,22-25H2,1-7H3/t26-,29-,30+/m0/s1 |
| InChIKey | MFZFVJDQEDGHCP-BHBSRLOASA-N |
| XLogP | 6.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.84 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|