C15H24FNO — CID 107456933
N-[[4-fluoro-3-(2-methylpropoxymethyl)phenyl]methyl]propan-1-amine (PubChem CID 107456933) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is N-[[4-fluoro-3-(2-methylpropoxymethyl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-fluoro-3-(2-methylpropoxymethyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107456933 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-[[4-fluoro-3-(2-methylpropoxymethyl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(F)c(COCC(C)C)c1 |
| InChI | InChI=1S/C15H24FNO/c1-4-7-17-9-13-5-6-15(16)14(8-13)11-18-10-12(2)3/h5-6,8,12,17H,4,7,9-11H2,1-3H3 |
| InChIKey | AJRVZOZIBHKMCN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|