C27H41N5O7Si — CID 10745726
prop-2-enyl (1S,2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-9-[[(E)-N'-prop-2-enoxycarbonylcarbamimidoyl]carbamoyl]-5,9-diazatricyclo[5.4.0.02,5]undec-6-ene-6-carboxylate (PubChem CID 10745726) has the molecular formula C27H41N5O7Si and a molecular weight of 575.74 g/mol. Its IUPAC name is prop-2-enyl (1S,2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-9-[[(E)-N'-prop-2-enoxycarbonylcarbamimidoyl]carbamoyl]-5,9-diazatricyclo[5.4.0.02,5]undec-6-ene-6-carboxylate.
| Compound Name | prop-2-enyl (1S,2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-9-[[(E)-N'-prop-2-enoxycarbonylcarbamimidoyl]carbamoyl]-5,9-diazatricyclo[5.4.0.02,5]undec-6-ene-6-carboxylate |
|---|---|
| PubChem CID | 10745726 |
| Molecular Formula | C27H41N5O7Si |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | prop-2-enyl (1S,2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-9-[[(E)-N'-prop-2-enoxycarbonylcarbamimidoyl]carbamoyl]-5,9-diazatricyclo[5.4.0.02,5]undec-6-ene-6-carboxylate |
| SMILES | C=CCOC(=O)/N=C(\N)NC(=O)N1CC[C@H]2C(=C(C(=O)OCC=C)N3C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@@H]23)C1 |
| InChI | InChI=1S/C27H41N5O7Si/c1-9-13-37-23(34)21-18-15-31(25(35)29-24(28)30-26(36)38-14-10-2)12-11-17(18)20-19(22(33)32(20)21)16(3)39-40(7,8)27(4,5)6/h9-10,16-17,19-20H,1-2,11-15H2,3-8H3,(H3,28,29,30,35,36)/t16-,17+,19-,20-/m1/s1 |
| InChIKey | BUUCTLGYLFMCFA-PIKOESSRSA-N |
| XLogP | 2.89 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|