C16H21NO2S2 — CID 107458064
(7,7-dimethyl-1,4-thiazepan-4-yl)-[5-(4-hydroxybut-1-ynyl)thiophen-3-yl]methanone (PubChem CID 107458064) has the molecular formula C16H21NO2S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is (7,7-dimethyl-1,4-thiazepan-4-yl)-[5-(4-hydroxybut-1-ynyl)thiophen-3-yl]methanone.
| Compound Name | (7,7-dimethyl-1,4-thiazepan-4-yl)-[5-(4-hydroxybut-1-ynyl)thiophen-3-yl]methanone |
|---|---|
| PubChem CID | 107458064 |
| Molecular Formula | C16H21NO2S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (7,7-dimethyl-1,4-thiazepan-4-yl)-[5-(4-hydroxybut-1-ynyl)thiophen-3-yl]methanone |
| SMILES | CC1(C)CCN(C(=O)c2csc(C#CCCO)c2)CCS1 |
| InChI | InChI=1S/C16H21NO2S2/c1-16(2)6-7-17(8-10-21-16)15(19)13-11-14(20-12-13)5-3-4-9-18/h11-12,18H,4,6-10H2,1-2H3 |
| InChIKey | TXXWRFCZABGJJV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|