About 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane
4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane (PubChem CID 107458314) has the molecular formula C17H21ClN2S
and a molecular weight of 320.89 g/mol. Its IUPAC name is 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane |
| PubChem CID | 107458314 |
| Molecular Formula | C17H21ClN2S |
| Molecular Weight | 320.89 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane |
| SMILES | CC1(C)CCN(c2ncc(CCl)c3ccccc23)CCS1 |
| InChI | InChI=1S/C17H21ClN2S/c1-17(2)7-8-20(9-10-21-17)16-15-6-4-3-5-14(15)13(11-18)12-19-16/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | GOXJZDGOTXCXQP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.89 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane?
The IUPAC name of 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane (CID 107458314) is 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane.
What is the SMILES notation for 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane?
The canonical SMILES for 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane is CC1(C)CCN(c2ncc(CCl)c3ccccc23)CCS1.
What is the InChIKey of 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane?
The InChIKey is GOXJZDGOTXCXQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN2S/c1-17(2)7-8-20(9-10-21-17)16-15-6-4-3-5-14(15)13(11-18)12-19-16/h3-6,12H,7-11H2,1-2H3.
What are the key properties of 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane?
4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane has a molecular weight of 320.89 g/mol, XLogP of 4.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(chloromethyl)isoquinolin-1-yl]-7,7-dimethyl-1,4-thiazepane is sourced from PubChem (CID 107458314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).