C14H15BrFN3OS — CID 107458562
3-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]-4-fluorobenzohydrazide (PubChem CID 107458562) has the molecular formula C14H15BrFN3OS and a molecular weight of 372.26 g/mol. Its IUPAC name is 3-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]-4-fluorobenzohydrazide.
| Compound Name | 3-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 107458562 |
| Molecular Formula | C14H15BrFN3OS |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 3-[[(5-bromothiophen-3-yl)methyl-methylamino]methyl]-4-fluorobenzohydrazide |
| SMILES | CN(Cc1csc(Br)c1)Cc1cc(C(=O)NN)ccc1F |
| InChI | InChI=1S/C14H15BrFN3OS/c1-19(6-9-4-13(15)21-8-9)7-11-5-10(14(20)18-17)2-3-12(11)16/h2-5,8H,6-7,17H2,1H3,(H,18,20) |
| InChIKey | OYJLLCPUMFONLF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|