C22H7BrF10N2O — CID 10745885
[5-[(5-bromo-1H-pyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 10745885) has the molecular formula C22H7BrF10N2O and a molecular weight of 585.20 g/mol. Its IUPAC name is [5-[(5-bromo-1H-pyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | [5-[(5-bromo-1H-pyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 10745885 |
| Molecular Formula | C22H7BrF10N2O |
| Molecular Weight | 585.20 g/mol |
| Exact Mass | 583.96 |
| IUPAC Name | [5-[(5-bromo-1H-pyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(c1ccc(C(c2ccc(Br)[nH]2)c2c(F)c(F)c(F)c(F)c2F)[nH]1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H7BrF10N2O/c23-8-4-3-6(35-8)9(10-12(24)16(28)20(32)17(29)13(10)25)5-1-2-7(34-5)22(36)11-14(26)18(30)21(33)19(31)15(11)27/h1-4,9,34-35H |
| InChIKey | ZZRNBDAZMCGVEO-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.20 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|