C35H58O5Si — CID 10745915
(E)-10-[tert-butyl(dimethyl)silyl]oxy-1-[2-hydroxy-4-(2-methyloctan-2-yl)-6-prop-2-enoxyphenyl]-7-methyldec-6-en-8-yne-1,3-diol (PubChem CID 10745915) has the molecular formula C35H58O5Si and a molecular weight of 586.93 g/mol. Its IUPAC name is (E)-10-[tert-butyl(dimethyl)silyl]oxy-1-[2-hydroxy-4-(2-methyloctan-2-yl)-6-prop-2-enoxyphenyl]-7-methyldec-6-en-8-yne-1,3-diol.
| Compound Name | (E)-10-[tert-butyl(dimethyl)silyl]oxy-1-[2-hydroxy-4-(2-methyloctan-2-yl)-6-prop-2-enoxyphenyl]-7-methyldec-6-en-8-yne-1,3-diol |
|---|---|
| PubChem CID | 10745915 |
| Molecular Formula | C35H58O5Si |
| Molecular Weight | 586.93 g/mol |
| Exact Mass | 586.41 |
| IUPAC Name | (E)-10-[tert-butyl(dimethyl)silyl]oxy-1-[2-hydroxy-4-(2-methyloctan-2-yl)-6-prop-2-enoxyphenyl]-7-methyldec-6-en-8-yne-1,3-diol |
| SMILES | C=CCOc1cc(C(C)(C)CCCCCC)cc(O)c1C(O)CC(O)CC/C=C(\C)C#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H58O5Si/c1-11-13-14-15-21-35(7,8)28-24-30(37)33(32(25-28)39-22-12-2)31(38)26-29(36)20-16-18-27(3)19-17-23-40-41(9,10)34(4,5)6/h12,18,24-25,29,31,36-38H,2,11,13-16,20-23,26H2,1,3-10H3/b27-18+ |
| InChIKey | TXVGJEZZVLUBIF-OVVQPSECSA-N |
| XLogP | 8.74 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.93 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|