C32H52N2O6Si — CID 10745945
benzyl (2S)-1-[(2S)-2-[[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-3-oxohexanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate (PubChem CID 10745945) has the molecular formula C32H52N2O6Si and a molecular weight of 588.86 g/mol. Its IUPAC name is benzyl (2S)-1-[(2S)-2-[[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-3-oxohexanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(2S)-2-[[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-3-oxohexanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10745945 |
| Molecular Formula | C32H52N2O6Si |
| Molecular Weight | 588.86 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | benzyl (2S)-1-[(2S)-2-[[(4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-3-oxohexanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)C[C@H](NC(=O)C(C)C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C)C(=O)N1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H52N2O6Si/c1-21(2)19-25(30(37)34-18-14-17-26(34)31(38)39-20-24-15-12-11-13-16-24)33-29(36)23(5)27(35)28(22(3)4)40-41(9,10)32(6,7)8/h11-13,15-16,21-23,25-26,28H,14,17-20H2,1-10H3,(H,33,36)/t23?,25-,26-,28-/m0/s1 |
| InChIKey | DIXDFBGVVFOXKZ-HMVMSKLBSA-N |
| XLogP | 5.50 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.86 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|