C15H26N2S2 — CID 107459695
2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N-[(5-methylthiophen-2-yl)methyl]ethanamine (PubChem CID 107459695) has the molecular formula C15H26N2S2 and a molecular weight of 298.52 g/mol. Its IUPAC name is 2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N-[(5-methylthiophen-2-yl)methyl]ethanamine.
| Compound Name | 2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N-[(5-methylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107459695 |
| Molecular Formula | C15H26N2S2 |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-(7,7-dimethyl-1,4-thiazepan-4-yl)-N-[(5-methylthiophen-2-yl)methyl]ethanamine |
| SMILES | Cc1ccc(CNCCN2CCSC(C)(C)CC2)s1 |
| InChI | InChI=1S/C15H26N2S2/c1-13-4-5-14(19-13)12-16-7-9-17-8-6-15(2,3)18-11-10-17/h4-5,16H,6-12H2,1-3H3 |
| InChIKey | NSYYVMSMCDONGT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|