About (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol
(E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol (PubChem CID 107460113) has the molecular formula C11H21NS2
and a molecular weight of 231.43 g/mol. Its IUPAC name is (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol.
Molecular Properties
| Compound Name | (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol |
| PubChem CID | 107460113 |
| Molecular Formula | C11H21NS2 |
| Molecular Weight | 231.43 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol |
| SMILES | CC1(C)CCN(C/C=C/CS)CCS1 |
| InChI | InChI=1S/C11H21NS2/c1-11(2)5-7-12(8-10-14-11)6-3-4-9-13/h3-4,13H,5-10H2,1-2H3/b4-3+ |
| InChIKey | PFTLFJQNJJFMCG-ONEGZZNKSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol?
The IUPAC name of (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol (CID 107460113) is (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol.
What is the SMILES notation for (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol?
The canonical SMILES for (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol is CC1(C)CCN(C/C=C/CS)CCS1.
What is the InChIKey of (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol?
The InChIKey is PFTLFJQNJJFMCG-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H21NS2/c1-11(2)5-7-12(8-10-14-11)6-3-4-9-13/h3-4,13H,5-10H2,1-2H3/b4-3+.
What are the key properties of (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol?
(E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol has a molecular weight of 231.43 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(7,7-dimethyl-1,4-thiazepan-4-yl)but-2-ene-1-thiol is sourced from PubChem (CID 107460113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).