C10H15N3O3 — CID 107460718
3-[1-(oxolan-2-ylmethyl)triazol-4-yl]propanoic acid (PubChem CID 107460718) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-[1-(oxolan-2-ylmethyl)triazol-4-yl]propanoic acid.
| Compound Name | 3-[1-(oxolan-2-ylmethyl)triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 107460718 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3-[1-(oxolan-2-ylmethyl)triazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1cn(CC2CCCO2)nn1 |
| InChI | InChI=1S/C10H15N3O3/c14-10(15)4-3-8-6-13(12-11-8)7-9-2-1-5-16-9/h6,9H,1-5,7H2,(H,14,15) |
| InChIKey | HWADFKYBXIRJMW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |