C10H4F5N3O2 — CID 107461204
2-[1-(2,3,4,5,6-pentafluorophenyl)triazol-4-yl]acetic acid (PubChem CID 107461204) has the molecular formula C10H4F5N3O2 and a molecular weight of 293.15 g/mol. Its IUPAC name is 2-[1-(2,3,4,5,6-pentafluorophenyl)triazol-4-yl]acetic acid.
| Compound Name | 2-[1-(2,3,4,5,6-pentafluorophenyl)triazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 107461204 |
| Molecular Formula | C10H4F5N3O2 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 2-[1-(2,3,4,5,6-pentafluorophenyl)triazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(-c2c(F)c(F)c(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C10H4F5N3O2/c11-5-6(12)8(14)10(9(15)7(5)13)18-2-3(16-17-18)1-4(19)20/h2H,1H2,(H,19,20) |
| InChIKey | VKTGMQSNYQHBGP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|