C38H68O3Si — CID 10746149
tert-butyl-[(2E,6Z,10E)-7-(dicyclohexyloxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenoxy]-dimethylsilane (PubChem CID 10746149) has the molecular formula C38H68O3Si and a molecular weight of 601.05 g/mol. Its IUPAC name is tert-butyl-[(2E,6Z,10E)-7-(dicyclohexyloxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6Z,10E)-7-(dicyclohexyloxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10746149 |
| Molecular Formula | C38H68O3Si |
| Molecular Weight | 601.05 g/mol |
| Exact Mass | 600.49 |
| IUPAC Name | tert-butyl-[(2E,6Z,10E)-7-(dicyclohexyloxymethyl)-3,11,15-trimethylhexadeca-2,6,10,14-tetraenoxy]-dimethylsilane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/CC/C(C)=C/CO[Si](C)(C)C(C)(C)C)C(OC1CCCCC1)OC1CCCCC1 |
| InChI | InChI=1S/C38H68O3Si/c1-31(2)19-16-20-32(3)21-17-23-34(24-18-22-33(4)29-30-39-42(8,9)38(5,6)7)37(40-35-25-12-10-13-26-35)41-36-27-14-11-15-28-36/h19,21,24,29,35-37H,10-18,20,22-23,25-28,30H2,1-9H3/b32-21+,33-29+,34-24- |
| InChIKey | VIUSOQURFQYJJZ-BCDBXADESA-N |
| XLogP | 12.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.05 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|