C30H31N7O7 — CID 10746158
methyl (2S,3S,4S,5R,6R)-6-[5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazol-2-yl]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 10746158) has the molecular formula C30H31N7O7 and a molecular weight of 601.62 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-6-[5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazol-2-yl]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-6-[5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazol-2-yl]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 10746158 |
| Molecular Formula | C30H31N7O7 |
| Molecular Weight | 601.62 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-6-[5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazol-2-yl]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](n2nnc(-c3ccccc3-c3ccc(CN4C(=O)CCc5c(C)nc(C)nc54)cc3)n2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H31N7O7/c1-15-19-12-13-22(38)36(28(19)32-16(2)31-15)14-17-8-10-18(11-9-17)20-6-4-5-7-21(20)27-33-35-37(34-27)29-25(41)23(39)24(40)26(44-29)30(42)43-3/h4-11,23-26,29,39-41H,12-14H2,1-3H3/t23-,24-,25+,26-,29+/m0/s1 |
| InChIKey | GEWUFQJMLHZBSD-LGUFPPMKSA-N |
| XLogP | 1.05 |
| TPSA | 185.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.62 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |