C9H8BrN3O2S — CID 107461850
2-[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]acetic acid (PubChem CID 107461850) has the molecular formula C9H8BrN3O2S and a molecular weight of 302.15 g/mol. Its IUPAC name is 2-[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]acetic acid.
| Compound Name | 2-[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 107461850 |
| Molecular Formula | C9H8BrN3O2S |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | 2-[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(Cc2csc(Br)c2)nn1 |
| InChI | InChI=1S/C9H8BrN3O2S/c10-8-1-6(5-16-8)3-13-4-7(11-12-13)2-9(14)15/h1,4-5H,2-3H2,(H,14,15) |
| InChIKey | YXARONMIZOMMMV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |