C11H21N3O2 — CID 107462393
N-(1,1-dimethoxypropan-2-yl)-3-ethyl-1-methylpyrazol-4-amine (PubChem CID 107462393) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)-3-ethyl-1-methylpyrazol-4-amine.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)-3-ethyl-1-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 107462393 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)-3-ethyl-1-methylpyrazol-4-amine |
| SMILES | CCc1nn(C)cc1NC(C)C(OC)OC |
| InChI | InChI=1S/C11H21N3O2/c1-6-9-10(7-14(3)13-9)12-8(2)11(15-4)16-5/h7-8,11-12H,6H2,1-5H3 |
| InChIKey | COETTZIFLWUSIJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|