C7H12N4S — CID 107462555
(3-ethyl-1-methylpyrazol-4-yl)thiourea (PubChem CID 107462555) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is (3-ethyl-1-methylpyrazol-4-yl)thiourea.
| Compound Name | (3-ethyl-1-methylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 107462555 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (3-ethyl-1-methylpyrazol-4-yl)thiourea |
| SMILES | CCc1nn(C)cc1NC(N)=S |
| InChI | InChI=1S/C7H12N4S/c1-3-5-6(9-7(8)12)4-11(2)10-5/h4H,3H2,1-2H3,(H3,8,9,12) |
| InChIKey | CBPHDOFYGCXKAR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|