C12H15N5O2S2 — CID 107463285
3-[(3-ethyl-1-methylpyrazol-4-yl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 107463285) has the molecular formula C12H15N5O2S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-[(3-ethyl-1-methylpyrazol-4-yl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 3-[(3-ethyl-1-methylpyrazol-4-yl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 107463285 |
| Molecular Formula | C12H15N5O2S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-[(3-ethyl-1-methylpyrazol-4-yl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | CCc1nn(C)cc1NS(=O)(=O)c1cccnc1C(N)=S |
| InChI | InChI=1S/C12H15N5O2S2/c1-3-8-9(7-17(2)15-8)16-21(18,19)10-5-4-6-14-11(10)12(13)20/h4-7,16H,3H2,1-2H3,(H2,13,20) |
| InChIKey | FIDREODSVQHGEK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|