C13H13F2N3O2 — CID 107463581
4-[(3-ethyl-1-methylpyrazol-4-yl)amino]-2,3-difluorobenzoic acid (PubChem CID 107463581) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is 4-[(3-ethyl-1-methylpyrazol-4-yl)amino]-2,3-difluorobenzoic acid.
| Compound Name | 4-[(3-ethyl-1-methylpyrazol-4-yl)amino]-2,3-difluorobenzoic acid |
|---|---|
| PubChem CID | 107463581 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-[(3-ethyl-1-methylpyrazol-4-yl)amino]-2,3-difluorobenzoic acid |
| SMILES | CCc1nn(C)cc1Nc1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C13H13F2N3O2/c1-3-8-10(6-18(2)17-8)16-9-5-4-7(13(19)20)11(14)12(9)15/h4-6,16H,3H2,1-2H3,(H,19,20) |
| InChIKey | DMUBDXCDHWHHPM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |