C24H34F9N3O5 — CID 10746365
tert-butyl N-[(2S)-3-methyl-1-[(2S)-2-[(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)carbamoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate (PubChem CID 10746365) has the molecular formula C24H34F9N3O5 and a molecular weight of 615.53 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-[(2S)-2-[(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)carbamoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-[(2S)-2-[(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)carbamoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10746365 |
| Molecular Formula | C24H34F9N3O5 |
| Molecular Weight | 615.53 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-[(2S)-2-[(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)carbamoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H34F9N3O5/c1-11(2)14(16(37)21(25,26)22(27,28)23(29,30)24(31,32)33)34-17(38)13-9-8-10-36(13)18(39)15(12(3)4)35-19(40)41-20(5,6)7/h11-15H,8-10H2,1-7H3,(H,34,38)(H,35,40)/t13-,14?,15-/m0/s1 |
| InChIKey | RTUWOXKDVWXWBE-LWEDLAQUSA-N |
| XLogP | 4.70 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|