C14H16N4OS — CID 107463881
3-(3-ethyl-1-methylpyrazol-4-yl)-5-methoxy-1H-benzimidazole-2-thione (PubChem CID 107463881) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 3-(3-ethyl-1-methylpyrazol-4-yl)-5-methoxy-1H-benzimidazole-2-thione.
| Compound Name | 3-(3-ethyl-1-methylpyrazol-4-yl)-5-methoxy-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107463881 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-(3-ethyl-1-methylpyrazol-4-yl)-5-methoxy-1H-benzimidazole-2-thione |
| SMILES | CCc1nn(C)cc1-n1c(=S)[nH]c2ccc(OC)cc21 |
| InChI | InChI=1S/C14H16N4OS/c1-4-10-13(8-17(2)16-10)18-12-7-9(19-3)5-6-11(12)15-14(18)20/h5-8H,4H2,1-3H3,(H,15,20) |
| InChIKey | WSPXDPQWZKEHHX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|