About CID 10746412
CID 10746412 (PubChem CID 10746412) has the molecular formula C30H50FeN4O2S2+2
and a molecular weight of 618.74 g/mol.
Molecular Properties
| Compound Name | CID 10746412 |
| PubChem CID | 10746412 |
| Molecular Formula | C30H50FeN4O2S2+2 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | — |
| SMILES | COC[C@@H]1CCCN1NC([C]1[CH][CH][CH][CH]1)[C@@H](C)SC.COC[C@@H]1CCCN1NC([C]1[CH][CH][CH][CH]1)[C@H](C)SC.[Fe+2] |
| InChI | InChI=1S/2C15H25N2OS.Fe/c2*1-12(19-3)15(13-7-4-5-8-13)16-17-10-6-9-14(17)11-18-2;/h2*4-5,7-8,12,14-16H,6,9-11H2,1-3H3;/q;;+2/t12-,14+,15?;12-,14-,15?;/m10./s1 |
| InChIKey | QXFOSLPPYDNHFS-CISSYIPESA-N |
| XLogP | 4.25 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10746412 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10746412?
The IUPAC name of CID 10746412 (CID 10746412) is not available.
What is the SMILES notation for CID 10746412?
The canonical SMILES for CID 10746412 is COC[C@@H]1CCCN1NC([C]1[CH][CH][CH][CH]1)[C@@H](C)SC.COC[C@@H]1CCCN1NC([C]1[CH][CH][CH][CH]1)[C@H](C)SC.[Fe+2].
What is the InChIKey of CID 10746412?
The InChIKey is QXFOSLPPYDNHFS-CISSYIPESA-N. The full InChI is InChI=1S/2C15H25N2OS.Fe/c2*1-12(19-3)15(13-7-4-5-8-13)16-17-10-6-9-14(17)11-18-2;/h2*4-5,7-8,12,14-16H,6,9-11H2,1-3H3;/q;;+2/t12-,14+,15?;12-,14-,15?;/m10./s1.
What are the key properties of CID 10746412?
CID 10746412 has a molecular weight of 618.74 g/mol, XLogP of 4.25, 14 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10746412 is sourced from PubChem (CID 10746412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).