C14H22N4O3 — CID 107464205
2-[(3-ethyl-1-methylpyrazol-4-yl)carbamoylamino]-1-methylcyclopentane-1-carboxylic acid (PubChem CID 107464205) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[(3-ethyl-1-methylpyrazol-4-yl)carbamoylamino]-1-methylcyclopentane-1-carboxylic acid.
| Compound Name | 2-[(3-ethyl-1-methylpyrazol-4-yl)carbamoylamino]-1-methylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 107464205 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[(3-ethyl-1-methylpyrazol-4-yl)carbamoylamino]-1-methylcyclopentane-1-carboxylic acid |
| SMILES | CCc1nn(C)cc1NC(=O)NC1CCCC1(C)C(=O)O |
| InChI | InChI=1S/C14H22N4O3/c1-4-9-10(8-18(3)17-9)15-13(21)16-11-6-5-7-14(11,2)12(19)20/h8,11H,4-7H2,1-3H3,(H,19,20)(H2,15,16,21) |
| InChIKey | GZDNSQNAQBGXSQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |