C13H21N3O3 — CID 107464409
2-[(3-ethyl-1-methylpyrazol-4-yl)carbamoyl]-3,3-dimethylbutanoic acid (PubChem CID 107464409) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[(3-ethyl-1-methylpyrazol-4-yl)carbamoyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(3-ethyl-1-methylpyrazol-4-yl)carbamoyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 107464409 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[(3-ethyl-1-methylpyrazol-4-yl)carbamoyl]-3,3-dimethylbutanoic acid |
| SMILES | CCc1nn(C)cc1NC(=O)C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H21N3O3/c1-6-8-9(7-16(5)15-8)14-11(17)10(12(18)19)13(2,3)4/h7,10H,6H2,1-5H3,(H,14,17)(H,18,19) |
| InChIKey | RTJXMGJKVWIROL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|