C33H66O7Si2 — CID 10746584
1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,6-dimethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodec-11-en-3-yn-5-ol (PubChem CID 10746584) has the molecular formula C33H66O7Si2 and a molecular weight of 631.06 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,6-dimethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodec-11-en-3-yn-5-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,6-dimethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodec-11-en-3-yn-5-ol |
|---|---|
| PubChem CID | 10746584 |
| Molecular Formula | C33H66O7Si2 |
| Molecular Weight | 631.06 g/mol |
| Exact Mass | 630.43 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-10-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,6-dimethoxy-8-(2-methoxypropan-2-yloxy)-2-methyldodec-11-en-3-yn-5-ol |
| SMILES | C=CC(CCO[Si](C)(C)C(C)(C)C)CC(CC(OC)(OC)C(O)C#CC(C)CO[Si](C)(C)C(C)(C)C)OC(C)(C)OC |
| InChI | InChI=1S/C33H66O7Si2/c1-18-27(21-22-38-41(14,15)30(3,4)5)23-28(40-32(9,10)35-11)24-33(36-12,37-13)29(34)20-19-26(2)25-39-42(16,17)31(6,7)8/h18,26-29,34H,1,21-25H2,2-17H3 |
| InChIKey | APTSSKRHYVGJTM-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.06 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|