C11H16ClN3O2S — CID 107465924
N-(2-amino-5-chlorophenyl)-N-methylpyrrolidine-1-sulfonamide (PubChem CID 107465924) has the molecular formula C11H16ClN3O2S and a molecular weight of 289.79 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-N-methylpyrrolidine-1-sulfonamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-N-methylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 107465924 |
| Molecular Formula | C11H16ClN3O2S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-N-methylpyrrolidine-1-sulfonamide |
| SMILES | CN(c1cc(Cl)ccc1N)S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C11H16ClN3O2S/c1-14(11-8-9(12)4-5-10(11)13)18(16,17)15-6-2-3-7-15/h4-5,8H,2-3,6-7,13H2,1H3 |
| InChIKey | NZDVDRKLMBGEQE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|