C16H17ClN2S — CID 107466030
4-chloro-2-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-N-methylbenzene-1,2-diamine (PubChem CID 107466030) has the molecular formula C16H17ClN2S and a molecular weight of 304.85 g/mol. Its IUPAC name is 4-chloro-2-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-N-methylbenzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 107466030 |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.85 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-chloro-2-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-2-N-methylbenzene-1,2-diamine |
| SMILES | CN(CC1Cc2ccccc2S1)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C16H17ClN2S/c1-19(15-9-12(17)6-7-14(15)18)10-13-8-11-4-2-3-5-16(11)20-13/h2-7,9,13H,8,10,18H2,1H3 |
| InChIKey | QXLSGMUMOBWCGX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.85 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|