About 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid
2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid (PubChem CID 10746664) has the molecular formula C40H35N3O5
and a molecular weight of 637.74 g/mol. Its IUPAC name is 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid |
| PubChem CID | 10746664 |
| Molecular Formula | C40H35N3O5 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.26 |
| IUPAC Name | 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid |
| SMILES | O=C(O)CON=C1CCC(c2ccc(OCc3ccc4ccccc4n3)cc2)(c2ccc(OCc3ccc4ccccc4n3)cc2)CC1 |
| InChI | InChI=1S/C40H35N3O5/c44-39(45)27-48-43-32-21-23-40(24-22-32,30-11-17-35(18-12-30)46-25-33-15-9-28-5-1-3-7-37(28)41-33)31-13-19-36(20-14-31)47-26-34-16-10-29-6-2-4-8-38(29)42-34/h1-20H,21-27H2,(H,44,45) |
| InChIKey | FQCYGUQVZKDJPN-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid?
The IUPAC name of 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid (CID 10746664) is 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid.
What is the SMILES notation for 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid?
The canonical SMILES for 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid is O=C(O)CON=C1CCC(c2ccc(OCc3ccc4ccccc4n3)cc2)(c2ccc(OCc3ccc4ccccc4n3)cc2)CC1.
What is the InChIKey of 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid?
The InChIKey is FQCYGUQVZKDJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H35N3O5/c44-39(45)27-48-43-32-21-23-40(24-22-32,30-11-17-35(18-12-30)46-25-33-15-9-28-5-1-3-7-37(28)41-33)31-13-19-36(20-14-31)47-26-34-16-10-29-6-2-4-8-38(29)42-34/h1-20H,21-27H2,(H,44,45).
What are the key properties of 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid?
2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid has a molecular weight of 637.74 g/mol, XLogP of 8.26, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]cyclohexylidene]amino]oxyacetic acid is sourced from PubChem (CID 10746664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).