C14H20N2O3 — CID 107467407
2-(2,2-diethoxyethylamino)-3-methoxybenzonitrile (PubChem CID 107467407) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(2,2-diethoxyethylamino)-3-methoxybenzonitrile.
| Compound Name | 2-(2,2-diethoxyethylamino)-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 107467407 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(2,2-diethoxyethylamino)-3-methoxybenzonitrile |
| SMILES | CCOC(CNc1c(C#N)cccc1OC)OCC |
| InChI | InChI=1S/C14H20N2O3/c1-4-18-13(19-5-2)10-16-14-11(9-15)7-6-8-12(14)17-3/h6-8,13,16H,4-5,10H2,1-3H3 |
| InChIKey | MOQXWVLBWXGYEC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|