C16H23N3O2 — CID 107467787
3-(aminomethyl)-N-(2-cyano-6-methoxyphenyl)-5-methylhexanamide (PubChem CID 107467787) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-cyano-6-methoxyphenyl)-5-methylhexanamide.
| Compound Name | 3-(aminomethyl)-N-(2-cyano-6-methoxyphenyl)-5-methylhexanamide |
|---|---|
| PubChem CID | 107467787 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 3-(aminomethyl)-N-(2-cyano-6-methoxyphenyl)-5-methylhexanamide |
| SMILES | COc1cccc(C#N)c1NC(=O)CC(CN)CC(C)C |
| InChI | InChI=1S/C16H23N3O2/c1-11(2)7-12(9-17)8-15(20)19-16-13(10-18)5-4-6-14(16)21-3/h4-6,11-12H,7-9,17H2,1-3H3,(H,19,20) |
| InChIKey | UTXQLGQXVSBNQR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |