C13H20N2O3S2 — CID 107468665
3-methoxy-2-(3-methylbutylsulfonylamino)benzenecarbothioamide (PubChem CID 107468665) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-methoxy-2-(3-methylbutylsulfonylamino)benzenecarbothioamide.
| Compound Name | 3-methoxy-2-(3-methylbutylsulfonylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107468665 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-methoxy-2-(3-methylbutylsulfonylamino)benzenecarbothioamide |
| SMILES | COc1cccc(C(N)=S)c1NS(=O)(=O)CCC(C)C |
| InChI | InChI=1S/C13H20N2O3S2/c1-9(2)7-8-20(16,17)15-12-10(13(14)19)5-4-6-11(12)18-3/h4-6,9,15H,7-8H2,1-3H3,(H2,14,19) |
| InChIKey | UBBVOLQBEPJACF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|