C14H15N3O4 — CID 107468882
2-[(2-cyano-6-methoxyphenyl)carbamoylamino]pent-4-enoic acid (PubChem CID 107468882) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[(2-cyano-6-methoxyphenyl)carbamoylamino]pent-4-enoic acid.
| Compound Name | 2-[(2-cyano-6-methoxyphenyl)carbamoylamino]pent-4-enoic acid |
|---|---|
| PubChem CID | 107468882 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[(2-cyano-6-methoxyphenyl)carbamoylamino]pent-4-enoic acid |
| SMILES | C=CCC(NC(=O)Nc1c(C#N)cccc1OC)C(=O)O |
| InChI | InChI=1S/C14H15N3O4/c1-3-5-10(13(18)19)16-14(20)17-12-9(8-15)6-4-7-11(12)21-2/h3-4,6-7,10H,1,5H2,2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | YXILLEPDOYUMIQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|