C16H19NO4 — CID 107469497
(2-amino-3-methoxyphenyl)-(3,5-dimethoxyphenyl)methanol (PubChem CID 107469497) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2-amino-3-methoxyphenyl)-(3,5-dimethoxyphenyl)methanol.
| Compound Name | (2-amino-3-methoxyphenyl)-(3,5-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 107469497 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2-amino-3-methoxyphenyl)-(3,5-dimethoxyphenyl)methanol |
| SMILES | COc1cc(OC)cc(C(O)c2cccc(OC)c2N)c1 |
| InChI | InChI=1S/C16H19NO4/c1-19-11-7-10(8-12(9-11)20-2)16(18)13-5-4-6-14(21-3)15(13)17/h4-9,16,18H,17H2,1-3H3 |
| InChIKey | WAIKPOVADYATRK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|