C40H40O9 — CID 10746959
4-[(4R,5R)-4,5-bis[hydroxy-bis(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-2-yl]phenol (PubChem CID 10746959) has the molecular formula C40H40O9 and a molecular weight of 664.75 g/mol. Its IUPAC name is 4-[(4R,5R)-4,5-bis[hydroxy-bis(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-2-yl]phenol.
| Compound Name | 4-[(4R,5R)-4,5-bis[hydroxy-bis(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-2-yl]phenol |
|---|---|
| PubChem CID | 10746959 |
| Molecular Formula | C40H40O9 |
| Molecular Weight | 664.75 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | 4-[(4R,5R)-4,5-bis[hydroxy-bis(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-2-yl]phenol |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)[C@@H]2OC(C)(c3ccc(O)cc3)O[C@H]2C(O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H40O9/c1-38(26-6-16-31(41)17-7-26)48-36(39(42,27-8-18-32(44-2)19-9-27)28-10-20-33(45-3)21-11-28)37(49-38)40(43,29-12-22-34(46-4)23-13-29)30-14-24-35(47-5)25-15-30/h6-25,36-37,41-43H,1-5H3/t36-,37-/m1/s1 |
| InChIKey | XDIRRYRXEOXWOH-FZNHDDJXSA-N |
| XLogP | 6.26 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.75 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |