About 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile
2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile (PubChem CID 107470100) has the molecular formula C13H11N3O4
and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile.
Molecular Properties
| Compound Name | 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile |
| PubChem CID | 107470100 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile |
| SMILES | COc1cccc(C#N)c1-n1c(O)c(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H11N3O4/c1-7-11(17)15-13(19)16(12(7)18)10-8(6-14)4-3-5-9(10)20-2/h3-5,18H,1-2H3,(H,15,17,19) |
| InChIKey | OXCWNXRKIMZWOK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile?
The IUPAC name of 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile (CID 107470100) is 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile.
What is the SMILES notation for 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile?
The canonical SMILES for 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile is COc1cccc(C#N)c1-n1c(O)c(C)c(=O)[nH]c1=O.
What is the InChIKey of 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile?
The InChIKey is OXCWNXRKIMZWOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O4/c1-7-11(17)15-13(19)16(12(7)18)10-8(6-14)4-3-5-9(10)20-2/h3-5,18H,1-2H3,(H,15,17,19).
What are the key properties of 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile?
2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile has a molecular weight of 273.25 g/mol, XLogP of 0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-hydroxy-5-methyl-2,4-dioxopyrimidin-1-yl)-3-methoxybenzonitrile is sourced from PubChem (CID 107470100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).