C18H28N2O — CID 107471215
2-(aminomethyl)-N-benzyl-N-cyclopropyl-4,4-dimethylpentanamide (PubChem CID 107471215) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-(aminomethyl)-N-benzyl-N-cyclopropyl-4,4-dimethylpentanamide.
| Compound Name | 2-(aminomethyl)-N-benzyl-N-cyclopropyl-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 107471215 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-(aminomethyl)-N-benzyl-N-cyclopropyl-4,4-dimethylpentanamide |
| SMILES | CC(C)(C)CC(CN)C(=O)N(Cc1ccccc1)C1CC1 |
| InChI | InChI=1S/C18H28N2O/c1-18(2,3)11-15(12-19)17(21)20(16-9-10-16)13-14-7-5-4-6-8-14/h4-8,15-16H,9-13,19H2,1-3H3 |
| InChIKey | RXOZDFKMMNLCJA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |