C16H26N2O2 — CID 107471998
2-(aminomethyl)-N-(2-methoxyphenyl)-N,4,4-trimethylpentanamide (PubChem CID 107471998) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-methoxyphenyl)-N,4,4-trimethylpentanamide.
| Compound Name | 2-(aminomethyl)-N-(2-methoxyphenyl)-N,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 107471998 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-(aminomethyl)-N-(2-methoxyphenyl)-N,4,4-trimethylpentanamide |
| SMILES | COc1ccccc1N(C)C(=O)C(CN)CC(C)(C)C |
| InChI | InChI=1S/C16H26N2O2/c1-16(2,3)10-12(11-17)15(19)18(4)13-8-6-7-9-14(13)20-5/h6-9,12H,10-11,17H2,1-5H3 |
| InChIKey | WCAFJUAOBKHGDK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |