C17H28N2O — CID 107472103
2-(aminomethyl)-4,4-dimethyl-N-(1-phenylpropan-2-yl)pentanamide (PubChem CID 107472103) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(aminomethyl)-4,4-dimethyl-N-(1-phenylpropan-2-yl)pentanamide.
| Compound Name | 2-(aminomethyl)-4,4-dimethyl-N-(1-phenylpropan-2-yl)pentanamide |
|---|---|
| PubChem CID | 107472103 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 2-(aminomethyl)-4,4-dimethyl-N-(1-phenylpropan-2-yl)pentanamide |
| SMILES | CC(Cc1ccccc1)NC(=O)C(CN)CC(C)(C)C |
| InChI | InChI=1S/C17H28N2O/c1-13(10-14-8-6-5-7-9-14)19-16(20)15(12-18)11-17(2,3)4/h5-9,13,15H,10-12,18H2,1-4H3,(H,19,20) |
| InChIKey | JXWJLXVIAOZZEX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |