C30H46O16S — CID 10747232
[(2R,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-ethylsulfanyl-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]hexyl] acetate (PubChem CID 10747232) has the molecular formula C30H46O16S and a molecular weight of 694.75 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-ethylsulfanyl-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]hexyl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-ethylsulfanyl-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]hexyl] acetate |
|---|---|
| PubChem CID | 10747232 |
| Molecular Formula | C30H46O16S |
| Molecular Weight | 694.75 g/mol |
| Exact Mass | 694.25 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-ethylsulfanyl-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]hexyl] acetate |
| SMILES | CCS[C@@H](OC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C30H46O16S/c1-11-47-28(37-13-20-22-24(44-29(7,8)43-22)25-27(42-20)46-30(9,10)45-25)26(41-18(6)35)23(40-17(5)34)21(39-16(4)33)19(38-15(3)32)12-36-14(2)31/h19-28H,11-13H2,1-10H3/t19-,20-,21-,22+,23+,24+,25-,26-,27-,28-/m1/s1 |
| InChIKey | JCOCZSCQHMGFHM-GVLTZMOESA-N |
| XLogP | 1.77 |
| TPSA | 186.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.75 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|