About 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid
2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid (PubChem CID 107472887) has the molecular formula C14H21NO5
and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid |
| PubChem CID | 107472887 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)CC(CN1C(=O)C2CCC(O2)C1=O)C(=O)O |
| InChI | InChI=1S/C14H21NO5/c1-14(2,3)6-8(13(18)19)7-15-11(16)9-4-5-10(20-9)12(15)17/h8-10H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | PPOXEIFCUOHQCN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid?
The IUPAC name of 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid (CID 107472887) is 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid.
What is the SMILES notation for 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid?
The canonical SMILES for 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid is CC(C)(C)CC(CN1C(=O)C2CCC(O2)C1=O)C(=O)O.
What is the InChIKey of 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid?
The InChIKey is PPOXEIFCUOHQCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO5/c1-14(2,3)6-8(13(18)19)7-15-11(16)9-4-5-10(20-9)12(15)17/h8-10H,4-7H2,1-3H3,(H,18,19).
What are the key properties of 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid?
2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid has a molecular weight of 283.32 g/mol, XLogP of 1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methyl]-4,4-dimethylpentanoic acid is sourced from PubChem (CID 107472887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).