C32H43F3N3O9P — CID 10747303
(4S)-5-(dipentylamino)-5-oxo-4-[[(2S)-3-(4-phosphonooxyphenyl)-2-[[4-(trifluoromethyl)benzoyl]amino]propanoyl]amino]pentanoic acid (PubChem CID 10747303) has the molecular formula C32H43F3N3O9P and a molecular weight of 701.68 g/mol. Its IUPAC name is (4S)-5-(dipentylamino)-5-oxo-4-[[(2S)-3-(4-phosphonooxyphenyl)-2-[[4-(trifluoromethyl)benzoyl]amino]propanoyl]amino]pentanoic acid.
| Compound Name | (4S)-5-(dipentylamino)-5-oxo-4-[[(2S)-3-(4-phosphonooxyphenyl)-2-[[4-(trifluoromethyl)benzoyl]amino]propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10747303 |
| Molecular Formula | C32H43F3N3O9P |
| Molecular Weight | 701.68 g/mol |
| Exact Mass | 701.27 |
| IUPAC Name | (4S)-5-(dipentylamino)-5-oxo-4-[[(2S)-3-(4-phosphonooxyphenyl)-2-[[4-(trifluoromethyl)benzoyl]amino]propanoyl]amino]pentanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H43F3N3O9P/c1-3-5-7-19-38(20-8-6-4-2)31(43)26(17-18-28(39)40)36-30(42)27(21-22-9-15-25(16-10-22)47-48(44,45)46)37-29(41)23-11-13-24(14-12-23)32(33,34)35/h9-16,26-27H,3-8,17-21H2,1-2H3,(H,36,42)(H,37,41)(H,39,40)(H2,44,45,46)/t26-,27-/m0/s1 |
| InChIKey | WCUHKCCFNMZDPR-SVBPBHIXSA-N |
| XLogP | 5.08 |
| TPSA | 182.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.68 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|