About N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine
N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine (PubChem CID 107473311) has the molecular formula C15H32N2
and a molecular weight of 240.43 g/mol. Its IUPAC name is N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine |
| PubChem CID | 107473311 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine |
| SMILES | CC(C)CN(CC(CN)CC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C15H32N2/c1-12(2)10-17(14-6-7-14)11-13(9-16)8-15(3,4)5/h12-14H,6-11,16H2,1-5H3 |
| InChIKey | NNWIGJZFWSDZPS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine?
The IUPAC name of N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine (CID 107473311) is N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine.
What is the SMILES notation for N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine?
The canonical SMILES for N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine is CC(C)CN(CC(CN)CC(C)(C)C)C1CC1.
What is the InChIKey of N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine?
The InChIKey is NNWIGJZFWSDZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2/c1-12(2)10-17(14-6-7-14)11-13(9-16)8-15(3,4)5/h12-14H,6-11,16H2,1-5H3.
What are the key properties of N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine?
N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine has a molecular weight of 240.43 g/mol, XLogP of 3.12, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-2-(2,2-dimethylpropyl)-N'-(2-methylpropyl)propane-1,3-diamine is sourced from PubChem (CID 107473311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).