C15H30N2O3S — CID 107474717
2-[(4-ethylsulfanylbutan-2-ylcarbamoylamino)methyl]-4,4-dimethylpentanoic acid (PubChem CID 107474717) has the molecular formula C15H30N2O3S and a molecular weight of 318.48 g/mol. Its IUPAC name is 2-[(4-ethylsulfanylbutan-2-ylcarbamoylamino)methyl]-4,4-dimethylpentanoic acid.
| Compound Name | 2-[(4-ethylsulfanylbutan-2-ylcarbamoylamino)methyl]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 107474717 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 2-[(4-ethylsulfanylbutan-2-ylcarbamoylamino)methyl]-4,4-dimethylpentanoic acid |
| SMILES | CCSCCC(C)NC(=O)NCC(CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H30N2O3S/c1-6-21-8-7-11(2)17-14(20)16-10-12(13(18)19)9-15(3,4)5/h11-12H,6-10H2,1-5H3,(H,18,19)(H2,16,17,20) |
| InChIKey | ZGZAQKRFRJXFAR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|