C14H20N2O4 — CID 107475160
4,4-dimethyl-2-[(4-nitroanilino)methyl]pentanoic acid (PubChem CID 107475160) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(4-nitroanilino)methyl]pentanoic acid.
| Compound Name | 4,4-dimethyl-2-[(4-nitroanilino)methyl]pentanoic acid |
|---|---|
| PubChem CID | 107475160 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4,4-dimethyl-2-[(4-nitroanilino)methyl]pentanoic acid |
| SMILES | CC(C)(C)CC(CNc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O4/c1-14(2,3)8-10(13(17)18)9-15-11-4-6-12(7-5-11)16(19)20/h4-7,10,15H,8-9H2,1-3H3,(H,17,18) |
| InChIKey | JFUBBIQWOJVEJA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|