C49H50O6 — CID 10747546
(4R,5R)-4,5-bis[(1R)-1-methoxy-2-trityloxyethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10747546) has the molecular formula C49H50O6 and a molecular weight of 734.93 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[(1R)-1-methoxy-2-trityloxyethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4,5-bis[(1R)-1-methoxy-2-trityloxyethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10747546 |
| Molecular Formula | C49H50O6 |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.36 |
| IUPAC Name | (4R,5R)-4,5-bis[(1R)-1-methoxy-2-trityloxyethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CO[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H]1OC(C)(C)O[C@@H]1[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C49H50O6/c1-47(2)54-45(43(50-3)35-52-48(37-23-11-5-12-24-37,38-25-13-6-14-26-38)39-27-15-7-16-28-39)46(55-47)44(51-4)36-53-49(40-29-17-8-18-30-40,41-31-19-9-20-32-41)42-33-21-10-22-34-42/h5-34,43-46H,35-36H2,1-4H3/t43-,44-,45-,46-/m1/s1 |
| InChIKey | AXOIIVBRGBTHSL-AXRJLGSNSA-N |
| XLogP | 9.55 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|