C14H24N2O3 — CID 107475626
2-[[2-(azetidin-3-ylidene)propanoylamino]methyl]-4,4-dimethylpentanoic acid (PubChem CID 107475626) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[[2-(azetidin-3-ylidene)propanoylamino]methyl]-4,4-dimethylpentanoic acid.
| Compound Name | 2-[[2-(azetidin-3-ylidene)propanoylamino]methyl]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 107475626 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-[[2-(azetidin-3-ylidene)propanoylamino]methyl]-4,4-dimethylpentanoic acid |
| SMILES | CC(C(=O)NCC(CC(C)(C)C)C(=O)O)=C1CNC1 |
| InChI | InChI=1S/C14H24N2O3/c1-9(11-6-15-7-11)12(17)16-8-10(13(18)19)5-14(2,3)4/h10,15H,5-8H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | UWBGYEPSJPJPJN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|